raaeraae22
raaeraae22
04-02-2017
Chemistry
contestada
When is di- used in the name of a hydrocarbon?
Respuesta :
DoctorCass
DoctorCass
04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link
VER TODAS LAS RESPUESTAS ( 23+ )
Otras preguntas
Select the correct answer from each drop-down menu. Some of the images in the diagram are images of polygon 1 from similarity transformations. Graph shows 5 pol
Light with a wavelength of 550 nm is traveling through a 50 kg block of ice (n=1.3). How fast is the light traveling in m/s?
How is the new theory of addiction different from the old theory of addiction? Explain how drugs are different from natural reinforcers.
Select the correct answer from each drop-down menu. Some of the images in the diagram are images of polygon 1 from similarity transformations. Graph shows 5 pol
. A potential difference of 12 V across a resistor produces a current of 16 mA. (a) What is the value of the resistor? (b) Assuming the resistor is ohmic, find
Please help this assignment is due in few hours and I am stuck on this question Find an equation for the graph sketched below:
Question is in the picture. And if you decide to answer, please explain said answer with all the steps and what not.
Question is in the picture. And if you decide to answer, please explain said answer with all the steps and what not.
I proceed to calculate the degree of angles and lengths of angle FBE but I'm not sure how to calculate the length of DF
explain why human language is more complex and sophisticated form of communication
